C15H11ClF3NO2S — CID 71283389
2-(3-chlorophenyl)sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 71283389) has the molecular formula C15H11ClF3NO2S and a molecular weight of 361.77 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-chlorophenyl)sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 71283389 |
| Molecular Formula | C15H11ClF3NO2S |
| Molecular Weight | 361.77 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 2-(3-chlorophenyl)sulfinyl-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CS(=O)c1cccc(Cl)c1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11ClF3NO2S/c16-11-2-1-3-13(8-11)23(22)9-14(21)20-12-6-4-10(5-7-12)15(17,18)19/h1-8H,9H2,(H,20,21) |
| InChIKey | GMNLWGBESPBBCN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |