C8H6ClF3OS — CID 174056486
1-chloro-3-(2,2,2-trifluoroethylsulfinyl)benzene (PubChem CID 174056486) has the molecular formula C8H6ClF3OS and a molecular weight of 242.65 g/mol. Its IUPAC name is 1-chloro-3-(2,2,2-trifluoroethylsulfinyl)benzene.
| Compound Name | 1-chloro-3-(2,2,2-trifluoroethylsulfinyl)benzene |
|---|---|
| PubChem CID | 174056486 |
| Molecular Formula | C8H6ClF3OS |
| Molecular Weight | 242.65 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 1-chloro-3-(2,2,2-trifluoroethylsulfinyl)benzene |
| SMILES | O=S(CC(F)(F)F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H6ClF3OS/c9-6-2-1-3-7(4-6)14(13)5-8(10,11)12/h1-4H,5H2 |
| InChIKey | VXAJSNBXUOVSTI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.65 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |