C17H10ClF3N2O3 — CID 113201563
2-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 113201563) has the molecular formula C17H10ClF3N2O3 and a molecular weight of 382.73 g/mol. Its IUPAC name is 2-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113201563 |
| Molecular Formula | C17H10ClF3N2O3 |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-(5-chloro-1,3-dioxoisoindol-2-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccc(Cl)cc2C1=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10ClF3N2O3/c18-10-3-6-12-13(7-10)16(26)23(15(12)25)8-14(24)22-11-4-1-9(2-5-11)17(19,20)21/h1-7H,8H2,(H,22,24) |
| InChIKey | PRLUSKDUEINOSN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|