C14H17Cl2N3O4 — CID 126563751
2-[[2-[(3,4-dichlorophenyl)carbamoylamino]acetyl]amino]pentanoic acid (PubChem CID 126563751) has the molecular formula C14H17Cl2N3O4 and a molecular weight of 362.21 g/mol. Its IUPAC name is 2-[[2-[(3,4-dichlorophenyl)carbamoylamino]acetyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[(3,4-dichlorophenyl)carbamoylamino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 126563751 |
| Molecular Formula | C14H17Cl2N3O4 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-[[2-[(3,4-dichlorophenyl)carbamoylamino]acetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)CNC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C14H17Cl2N3O4/c1-2-3-11(13(21)22)19-12(20)7-17-14(23)18-8-4-5-9(15)10(16)6-8/h4-6,11H,2-3,7H2,1H3,(H,19,20)(H,21,22)(H2,17,18,23) |
| InChIKey | FMGHSVPDTVJVCH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |