C17H22Cl2N2O6 — CID 10740845
(2S)-2-[[4-[bis(2-chloroethyl)amino]-2-methylphenoxy]carbonylamino]pentanedioic acid (PubChem CID 10740845) has the molecular formula C17H22Cl2N2O6 and a molecular weight of 421.28 g/mol. Its IUPAC name is (2S)-2-[[4-[bis(2-chloroethyl)amino]-2-methylphenoxy]carbonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[bis(2-chloroethyl)amino]-2-methylphenoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 10740845 |
| Molecular Formula | C17H22Cl2N2O6 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (2S)-2-[[4-[bis(2-chloroethyl)amino]-2-methylphenoxy]carbonylamino]pentanedioic acid |
| SMILES | Cc1cc(N(CCCl)CCCl)ccc1OC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H22Cl2N2O6/c1-11-10-12(21(8-6-18)9-7-19)2-4-14(11)27-17(26)20-13(16(24)25)3-5-15(22)23/h2,4,10,13H,3,5-9H2,1H3,(H,20,26)(H,22,23)(H,24,25)/t13-/m0/s1 |
| InChIKey | BKWYMUIOROCUHO-ZDUSSCGKSA-N |
| XLogP | 2.69 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|