C16H20I2N2O6 — CID 59325911
(2R)-2-[[4-[bis(2-iodoethyl)amino]phenoxy]carbonylamino]pentanedioic acid (PubChem CID 59325911) has the molecular formula C16H20I2N2O6 and a molecular weight of 590.15 g/mol. Its IUPAC name is (2R)-2-[[4-[bis(2-iodoethyl)amino]phenoxy]carbonylamino]pentanedioic acid.
| Compound Name | (2R)-2-[[4-[bis(2-iodoethyl)amino]phenoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 59325911 |
| Molecular Formula | C16H20I2N2O6 |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.94 |
| IUPAC Name | (2R)-2-[[4-[bis(2-iodoethyl)amino]phenoxy]carbonylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@@H](NC(=O)Oc1ccc(N(CCI)CCI)cc1)C(=O)O |
| InChI | InChI=1S/C16H20I2N2O6/c17-7-9-20(10-8-18)11-1-3-12(4-2-11)26-16(25)19-13(15(23)24)5-6-14(21)22/h1-4,13H,5-10H2,(H,19,25)(H,21,22)(H,23,24)/t13-/m1/s1 |
| InChIKey | GLJZEYQJFGCTQN-CYBMUJFWSA-N |
| XLogP | 2.77 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|