C26H34N4O7 — CID 58617944
(2S)-2-[[4-[[4-(dipropylamino)phenyl]carbamoyloxymethyl]phenyl]carbamoylamino]pentanedioic acid (PubChem CID 58617944) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (2S)-2-[[4-[[4-(dipropylamino)phenyl]carbamoyloxymethyl]phenyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[[4-(dipropylamino)phenyl]carbamoyloxymethyl]phenyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 58617944 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (2S)-2-[[4-[[4-(dipropylamino)phenyl]carbamoyloxymethyl]phenyl]carbamoylamino]pentanedioic acid |
| SMILES | CCCN(CCC)c1ccc(NC(=O)OCc2ccc(NC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H34N4O7/c1-3-15-30(16-4-2)21-11-9-20(10-12-21)28-26(36)37-17-18-5-7-19(8-6-18)27-25(35)29-22(24(33)34)13-14-23(31)32/h5-12,22H,3-4,13-17H2,1-2H3,(H,28,36)(H,31,32)(H,33,34)(H2,27,29,35)/t22-/m0/s1 |
| InChIKey | TVZFGSDXCBELKY-QFIPXVFZSA-N |
| XLogP | 4.50 |
| TPSA | 157.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|