C14H18N2O6 — CID 142867656
2-[[4-(methoxymethyl)phenyl]carbamoylamino]pentanedioic acid (PubChem CID 142867656) has the molecular formula C14H18N2O6 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-[[4-(methoxymethyl)phenyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[4-(methoxymethyl)phenyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 142867656 |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[[4-(methoxymethyl)phenyl]carbamoylamino]pentanedioic acid |
| SMILES | COCc1ccc(NC(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O6/c1-22-8-9-2-4-10(5-3-9)15-14(21)16-11(13(19)20)6-7-12(17)18/h2-5,11H,6-8H2,1H3,(H,17,18)(H,19,20)(H2,15,16,21) |
| InChIKey | IPXUQVOKTQGFQP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |