C14H17N3O7 — CID 78046840
2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioic acid (PubChem CID 78046840) has the molecular formula C14H17N3O7 and a molecular weight of 339.30 g/mol. Its IUPAC name is 2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioic acid.
| Compound Name | 2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 78046840 |
| Molecular Formula | C14H17N3O7 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)NNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H17N3O7/c18-11(19)7-6-10(12(20)21)15-13(22)16-17-14(23)24-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,17,23)(H,18,19)(H,20,21)(H2,15,16,22) |
| InChIKey | KVNFJPWTRLNWQF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|