C15H19NO6 — CID 67577410
(2S)-2-[(3-oxo-3-phenylmethoxypropyl)amino]pentanedioic acid (PubChem CID 67577410) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2S)-2-[(3-oxo-3-phenylmethoxypropyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(3-oxo-3-phenylmethoxypropyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 67577410 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2S)-2-[(3-oxo-3-phenylmethoxypropyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NCCC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H19NO6/c17-13(18)7-6-12(15(20)21)16-9-8-14(19)22-10-11-4-2-1-3-5-11/h1-5,12,16H,6-10H2,(H,17,18)(H,20,21)/t12-/m0/s1 |
| InChIKey | JIVACDJXIAFZNQ-LBPRGKRZSA-N |
| XLogP | 1.03 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |