C16H24N2O7 — CID 70073749
(2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid (PubChem CID 70073749) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 70073749 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid |
| SMILES | N[C@@H](CO)C(=O)O.O=C(O)CCN[C@H](CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17NO4.C3H7NO3/c15-12(16)8-9-14-11(13(17)18)7-6-10-4-2-1-3-5-10;4-2(1-5)3(6)7/h1-5,11,14H,6-9H2,(H,15,16)(H,17,18);2,5H,1,4H2,(H,6,7)/t11-;2-/m10/s1 |
| InChIKey | ASWDCTQUELPXSU-JZSAPEFASA-N |
| XLogP | -0.47 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |