About (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid
(2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid (PubChem CID 70089458) has the molecular formula C21H32N2O6
and a molecular weight of 408.50 g/mol. Its IUPAC name is (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid.
Molecular Properties
| Compound Name | (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid |
| PubChem CID | 70089458 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid |
| SMILES | O=C(O)CCN[C@H](CCc1ccccc1)C(=O)O.O=C(O)CNC1CCCCC1 |
| InChI | InChI=1S/C13H17NO4.C8H15NO2/c15-12(16)8-9-14-11(13(17)18)7-6-10-4-2-1-3-5-10;10-8(11)6-9-7-4-2-1-3-5-7/h1-5,11,14H,6-9H2,(H,15,16)(H,17,18);7,9H,1-6H2,(H,10,11)/t11-;/m1./s1 |
| InChIKey | QBUBHIXMGSHONW-RFVHGSKJSA-N |
| XLogP | 2.13 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid?
The IUPAC name of (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid (CID 70089458) is (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid.
What is the SMILES notation for (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid?
The canonical SMILES for (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid is O=C(O)CCN[C@H](CCc1ccccc1)C(=O)O.O=C(O)CNC1CCCCC1.
What is the InChIKey of (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid?
The InChIKey is QBUBHIXMGSHONW-RFVHGSKJSA-N. The full InChI is InChI=1S/C13H17NO4.C8H15NO2/c15-12(16)8-9-14-11(13(17)18)7-6-10-4-2-1-3-5-10;10-8(11)6-9-7-4-2-1-3-5-7/h1-5,11,14H,6-9H2,(H,15,16)(H,17,18);7,9H,1-6H2,(H,10,11)/t11-;/m1./s1.
What are the key properties of (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid?
(2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid has a molecular weight of 408.50 g/mol, XLogP of 2.13, 11 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2-carboxyethylamino)-4-phenylbutanoic acid;2-(cyclohexylamino)acetic acid is sourced from PubChem (CID 70089458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).