C20H29NO3 — CID 142774973
3-(3-cyclohexylpropylamino)-2-oxo-5-phenylpentanoic acid (PubChem CID 142774973) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-(3-cyclohexylpropylamino)-2-oxo-5-phenylpentanoic acid.
| Compound Name | 3-(3-cyclohexylpropylamino)-2-oxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 142774973 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 3-(3-cyclohexylpropylamino)-2-oxo-5-phenylpentanoic acid |
| SMILES | O=C(O)C(=O)C(CCc1ccccc1)NCCCC1CCCCC1 |
| InChI | InChI=1S/C20H29NO3/c22-19(20(23)24)18(14-13-17-10-5-2-6-11-17)21-15-7-12-16-8-3-1-4-9-16/h2,5-6,10-11,16,18,21H,1,3-4,7-9,12-15H2,(H,23,24) |
| InChIKey | BKYVGAUBJTYMFW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|