C24H40N4O2 — CID 20662149
(2R)-2,5-diamino-N-[(2S)-4-cyclohexyl-1-oxo-1-(3-phenylpropylamino)butan-2-yl]pentanamide (PubChem CID 20662149) has the molecular formula C24H40N4O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-[(2S)-4-cyclohexyl-1-oxo-1-(3-phenylpropylamino)butan-2-yl]pentanamide.
| Compound Name | (2R)-2,5-diamino-N-[(2S)-4-cyclohexyl-1-oxo-1-(3-phenylpropylamino)butan-2-yl]pentanamide |
|---|---|
| PubChem CID | 20662149 |
| Molecular Formula | C24H40N4O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.32 |
| IUPAC Name | (2R)-2,5-diamino-N-[(2S)-4-cyclohexyl-1-oxo-1-(3-phenylpropylamino)butan-2-yl]pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)N[C@@H](CCC1CCCCC1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C24H40N4O2/c25-17-7-14-21(26)23(29)28-22(16-15-20-11-5-2-6-12-20)24(30)27-18-8-13-19-9-3-1-4-10-19/h1,3-4,9-10,20-22H,2,5-8,11-18,25-26H2,(H,27,30)(H,28,29)/t21-,22+/m1/s1 |
| InChIKey | VHBFENOWZKEJBI-YADHBBJMSA-N |
| XLogP | 2.65 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|