C21H34N4O2 — CID 57398373
(2R)-2,5-diamino-N-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]pentanamide (PubChem CID 57398373) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]pentanamide.
| Compound Name | (2R)-2,5-diamino-N-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 57398373 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (2R)-2,5-diamino-N-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)NC(CCc1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H34N4O2/c22-15-7-12-18(23)20(26)25-19(14-13-16-8-3-1-4-9-16)21(27)24-17-10-5-2-6-11-17/h1,3-4,8-9,17-19H,2,5-7,10-15,22-23H2,(H,24,27)(H,25,26)/t18-,19?/m1/s1 |
| InChIKey | PUMGQXNRRKJWOC-MRTLOADZSA-N |
| XLogP | 1.62 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |