C24H29N5O2 — CID 123654597
(2S)-2,5-diamino-N-[(3R)-2-oxo-5-phenyl-1-quinoxalin-6-ylpentan-3-yl]pentanamide (PubChem CID 123654597) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is (2S)-2,5-diamino-N-[(3R)-2-oxo-5-phenyl-1-quinoxalin-6-ylpentan-3-yl]pentanamide.
| Compound Name | (2S)-2,5-diamino-N-[(3R)-2-oxo-5-phenyl-1-quinoxalin-6-ylpentan-3-yl]pentanamide |
|---|---|
| PubChem CID | 123654597 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | (2S)-2,5-diamino-N-[(3R)-2-oxo-5-phenyl-1-quinoxalin-6-ylpentan-3-yl]pentanamide |
| SMILES | NCCC[C@H](N)C(=O)N[C@H](CCc1ccccc1)C(=O)Cc1ccc2nccnc2c1 |
| InChI | InChI=1S/C24H29N5O2/c25-12-4-7-19(26)24(31)29-21(11-8-17-5-2-1-3-6-17)23(30)16-18-9-10-20-22(15-18)28-14-13-27-20/h1-3,5-6,9-10,13-15,19,21H,4,7-8,11-12,16,25-26H2,(H,29,31)/t19-,21+/m0/s1 |
| InChIKey | SXHXWGPXGKKRHO-PZJWPPBQSA-N |
| XLogP | 1.93 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |