C23H31N3O2S — CID 20662164
S-(2-ethylphenyl) (2S)-5-amino-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]pentanethioate (PubChem CID 20662164) has the molecular formula C23H31N3O2S and a molecular weight of 413.59 g/mol. Its IUPAC name is S-(2-ethylphenyl) (2S)-5-amino-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]pentanethioate.
| Compound Name | S-(2-ethylphenyl) (2S)-5-amino-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]pentanethioate |
|---|---|
| PubChem CID | 20662164 |
| Molecular Formula | C23H31N3O2S |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | S-(2-ethylphenyl) (2S)-5-amino-2-[[(2S)-2-amino-4-phenylbutanoyl]amino]pentanethioate |
| SMILES | CCc1ccccc1SC(=O)[C@H](CCCN)NC(=O)[C@@H](N)CCc1ccccc1 |
| InChI | InChI=1S/C23H31N3O2S/c1-2-18-11-6-7-13-21(18)29-23(28)20(12-8-16-24)26-22(27)19(25)15-14-17-9-4-3-5-10-17/h3-7,9-11,13,19-20H,2,8,12,14-16,24-25H2,1H3,(H,26,27)/t19-,20-/m0/s1 |
| InChIKey | OTUVSDPDPRYDMP-PMACEKPBSA-N |
| XLogP | 3.05 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|