C32H49N8O2+ — CID 159239820
[(4S)-4-amino-5-oxo-5-[[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]amino]pentyl]-bis(1,3-diaminopropan-2-yl)-methylazanium (PubChem CID 159239820) has the molecular formula C32H49N8O2+ and a molecular weight of 577.80 g/mol. Its IUPAC name is [(4S)-4-amino-5-oxo-5-[[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]amino]pentyl]-bis(1,3-diaminopropan-2-yl)-methylazanium.
| Compound Name | [(4S)-4-amino-5-oxo-5-[[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]amino]pentyl]-bis(1,3-diaminopropan-2-yl)-methylazanium |
|---|---|
| PubChem CID | 159239820 |
| Molecular Formula | C32H49N8O2+ |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 577.40 |
| IUPAC Name | [(4S)-4-amino-5-oxo-5-[[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]amino]pentyl]-bis(1,3-diaminopropan-2-yl)-methylazanium |
| SMILES | C[N+](CCC[C@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)Cc1cnc2ccccc2c1)(C(CN)CN)C(CN)CN |
| InChI | InChI=1S/C32H48N8O2/c1-40(26(18-33)19-34,27(20-35)21-36)15-7-11-28(37)32(42)39-30(14-13-23-8-3-2-4-9-23)31(41)17-24-16-25-10-5-6-12-29(25)38-22-24/h2-6,8-10,12,16,22,26-28,30H,7,11,13-15,17-21,33-37H2,1H3/p+1/t28-,30-/m0/s1 |
| InChIKey | BDKJMBKRVRGUEM-JDXGNMNLSA-O |
| XLogP | 0.59 |
| TPSA | 189.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|