C32H43N7O4 — CID 160624717
1-[6-amino-4-(2-aminoethyl)-3-oxohexyl]-1-[[(2S)-2-aminopropanoyl]amino]-3-[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]urea (PubChem CID 160624717) has the molecular formula C32H43N7O4 and a molecular weight of 589.74 g/mol. Its IUPAC name is 1-[6-amino-4-(2-aminoethyl)-3-oxohexyl]-1-[[(2S)-2-aminopropanoyl]amino]-3-[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]urea.
| Compound Name | 1-[6-amino-4-(2-aminoethyl)-3-oxohexyl]-1-[[(2S)-2-aminopropanoyl]amino]-3-[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]urea |
|---|---|
| PubChem CID | 160624717 |
| Molecular Formula | C32H43N7O4 |
| Molecular Weight | 589.74 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | 1-[6-amino-4-(2-aminoethyl)-3-oxohexyl]-1-[[(2S)-2-aminopropanoyl]amino]-3-[(3S)-2-oxo-5-phenyl-1-quinolin-3-ylpentan-3-yl]urea |
| SMILES | C[C@H](N)C(=O)NN(CCC(=O)C(CCN)CCN)C(=O)N[C@@H](CCc1ccccc1)C(=O)Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C32H43N7O4/c1-22(35)31(42)38-39(18-15-29(40)25(13-16-33)14-17-34)32(43)37-28(12-11-23-7-3-2-4-8-23)30(41)20-24-19-26-9-5-6-10-27(26)36-21-24/h2-10,19,21-22,25,28H,11-18,20,33-35H2,1H3,(H,37,43)(H,38,42)/t22-,28-/m0/s1 |
| InChIKey | JMUUQDDJPHKUKP-DWACAAAGSA-N |
| XLogP | 2.01 |
| TPSA | 186.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|