C30H41N11O3 — CID 25123870
(2S)-2-amino-N',N'-bis[2-(diaminomethylideneamino)ethyl]-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanediamide (PubChem CID 25123870) has the molecular formula C30H41N11O3 and a molecular weight of 603.73 g/mol. Its IUPAC name is (2S)-2-amino-N',N'-bis[2-(diaminomethylideneamino)ethyl]-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanediamide.
| Compound Name | (2S)-2-amino-N',N'-bis[2-(diaminomethylideneamino)ethyl]-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanediamide |
|---|---|
| PubChem CID | 25123870 |
| Molecular Formula | C30H41N11O3 |
| Molecular Weight | 603.73 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | (2S)-2-amino-N',N'-bis[2-(diaminomethylideneamino)ethyl]-N-[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanediamide |
| SMILES | NC(N)=NCCN(CCN=C(N)N)C(=O)CC[C@H](N)C(=O)N[C@H](CCc1ccccc1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C30H41N11O3/c31-23(11-13-26(42)41(16-14-36-29(32)33)17-15-37-30(34)35)27(43)40-25(12-10-20-6-2-1-3-7-20)28(44)39-22-18-21-8-4-5-9-24(21)38-19-22/h1-9,18-19,23,25H,10-17,31H2,(H,39,44)(H,40,43)(H4,32,33,36)(H4,34,35,37)/t23-,25+/m0/s1 |
| InChIKey | VHGXWOQDVRCPJW-UKILVPOCSA-N |
| XLogP | -0.23 |
| TPSA | 246.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.73 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|