C24H30BN6O — CID 70890633
CID 70890633 (PubChem CID 70890633) has the molecular formula C24H30BN6O and a molecular weight of 429.36 g/mol.
| Compound Name | CID 70890633 |
|---|---|
| PubChem CID | 70890633 |
| Molecular Formula | C24H30BN6O |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | — |
| SMILES | [B]=C(N[C@H](CCc1ccccc1)C(=O)Nc1cnc2ccccc2c1)[C@@H](N)CC(N)CN |
| InChI | InChI=1S/C24H30BN6O/c25-23(20(28)13-18(27)14-26)31-22(11-10-16-6-2-1-3-7-16)24(32)30-19-12-17-8-4-5-9-21(17)29-15-19/h1-9,12,15,18,20,22,31H,10-11,13-14,26-28H2,(H,30,32)/t18?,20-,22+/m0/s1 |
| InChIKey | OQFXHWTYVLESTD-DMYVWATESA-N |
| XLogP | 1.07 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|