C25H31N7O3 — CID 46221696
(2S)-2-amino-N',N'-bis(aminomethyl)-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]butanediamide (PubChem CID 46221696) has the molecular formula C25H31N7O3 and a molecular weight of 477.57 g/mol. Its IUPAC name is (2S)-2-amino-N',N'-bis(aminomethyl)-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]butanediamide.
| Compound Name | (2S)-2-amino-N',N'-bis(aminomethyl)-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]butanediamide |
|---|---|
| PubChem CID | 46221696 |
| Molecular Formula | C25H31N7O3 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | (2S)-2-amino-N',N'-bis(aminomethyl)-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]butanediamide |
| SMILES | NCN(CN)C(=O)C[C@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C25H31N7O3/c26-15-32(16-27)23(33)13-20(28)24(34)31-22(11-10-17-6-2-1-3-7-17)25(35)30-19-12-18-8-4-5-9-21(18)29-14-19/h1-9,12,14,20,22H,10-11,13,15-16,26-28H2,(H,30,35)(H,31,34)/t20-,22-/m0/s1 |
| InChIKey | WSCLRMPSFFPKIG-UNMCSNQZSA-N |
| XLogP | 0.67 |
| TPSA | 169.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|