C29H41N9O2 — CID 25124519
(2S)-2-amino-5-[bis(2-aminoethylamino)methylideneamino]-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide (PubChem CID 25124519) has the molecular formula C29H41N9O2 and a molecular weight of 547.71 g/mol. Its IUPAC name is (2S)-2-amino-5-[bis(2-aminoethylamino)methylideneamino]-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-5-[bis(2-aminoethylamino)methylideneamino]-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide |
|---|---|
| PubChem CID | 25124519 |
| Molecular Formula | C29H41N9O2 |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | (2S)-2-amino-5-[bis(2-aminoethylamino)methylideneamino]-N-[(2S)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]pentanamide |
| SMILES | NCCNC(=NCCC[C@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)Nc1cnc2ccccc2c1)NCCN |
| InChI | InChI=1S/C29H41N9O2/c30-14-17-34-29(35-18-15-31)33-16-6-10-24(32)27(39)38-26(13-12-21-7-2-1-3-8-21)28(40)37-23-19-22-9-4-5-11-25(22)36-20-23/h1-5,7-9,11,19-20,24,26H,6,10,12-18,30-32H2,(H,37,40)(H,38,39)(H2,33,34,35)/t24-,26-/m0/s1 |
| InChIKey | MOIJRUUFGJMURN-AHWVRZQESA-N |
| XLogP | 0.85 |
| TPSA | 185.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|