C29H40F3N8O2+ — CID 25130723
amino-bis(2-aminoethyl)-[(4S)-4-amino-5-oxo-5-[[(2S)-1-oxo-1-(quinolin-3-ylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-yl]amino]pentyl]azanium (PubChem CID 25130723) has the molecular formula C29H40F3N8O2+ and a molecular weight of 589.69 g/mol. Its IUPAC name is amino-bis(2-aminoethyl)-[(4S)-4-amino-5-oxo-5-[[(2S)-1-oxo-1-(quinolin-3-ylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-yl]amino]pentyl]azanium.
| Compound Name | amino-bis(2-aminoethyl)-[(4S)-4-amino-5-oxo-5-[[(2S)-1-oxo-1-(quinolin-3-ylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-yl]amino]pentyl]azanium |
|---|---|
| PubChem CID | 25130723 |
| Molecular Formula | C29H40F3N8O2+ |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | amino-bis(2-aminoethyl)-[(4S)-4-amino-5-oxo-5-[[(2S)-1-oxo-1-(quinolin-3-ylamino)-4-[3-(trifluoromethyl)phenyl]butan-2-yl]amino]pentyl]azanium |
| SMILES | NCC[N+](N)(CCN)CCC[C@H](N)C(=O)N[C@@H](CCc1cccc(C(F)(F)F)c1)C(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C29H39F3N8O2/c30-29(31,32)22-7-3-5-20(17-22)10-11-26(28(42)38-23-18-21-6-1-2-9-25(21)37-19-23)39-27(41)24(35)8-4-14-40(36,15-12-33)16-13-34/h1-3,5-7,9,17-19,24,26H,4,8,10-16,33-36H2,(H-,38,39,41,42)/p+1/t24-,26-/m0/s1 |
| InChIKey | MFKKDQWYJZTIBC-AHWVRZQESA-O |
| XLogP | 2.03 |
| TPSA | 175.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|