C31H44N9O2+ — CID 25129343
bis[2-(aminomethylideneamino)ethyl]-[(4S)-4-amino-5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]amino]pentyl]-methylazanium (PubChem CID 25129343) has the molecular formula C31H44N9O2+ and a molecular weight of 574.75 g/mol. Its IUPAC name is bis[2-(aminomethylideneamino)ethyl]-[(4S)-4-amino-5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]amino]pentyl]-methylazanium.
| Compound Name | bis[2-(aminomethylideneamino)ethyl]-[(4S)-4-amino-5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]amino]pentyl]-methylazanium |
|---|---|
| PubChem CID | 25129343 |
| Molecular Formula | C31H44N9O2+ |
| Molecular Weight | 574.75 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | bis[2-(aminomethylideneamino)ethyl]-[(4S)-4-amino-5-oxo-5-[[(2R)-1-oxo-4-phenyl-1-(quinolin-3-ylamino)butan-2-yl]amino]pentyl]-methylazanium |
| SMILES | C[N+](CCC[C@H](N)C(=O)N[C@H](CCc1ccccc1)C(=O)Nc1cnc2ccccc2c1)(CC/N=C/N)CC/N=C/N |
| InChI | InChI=1S/C31H43N9O2/c1-40(18-15-35-22-32,19-16-36-23-33)17-7-11-27(34)30(41)39-29(14-13-24-8-3-2-4-9-24)31(42)38-26-20-25-10-5-6-12-28(25)37-21-26/h2-6,8-10,12,20-23,27,29H,7,11,13-19,34H2,1H3,(H5-,32,33,35,36,38,39,41,42)/p+1/t27-,29+/m0/s1 |
| InChIKey | IDOXXZYDEOBMRZ-LMSSTIIKSA-O |
| XLogP | 1.82 |
| TPSA | 173.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|