C26H35N5O7S — CID 87216988
(2R)-2-[[(2S)-2,5-diaminopentanoyl]amino]-4-phenylbutanoic acid;methanesulfonic acid;quinoline-3-carboxamide (PubChem CID 87216988) has the molecular formula C26H35N5O7S and a molecular weight of 561.66 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2,5-diaminopentanoyl]amino]-4-phenylbutanoic acid;methanesulfonic acid;quinoline-3-carboxamide.
| Compound Name | (2R)-2-[[(2S)-2,5-diaminopentanoyl]amino]-4-phenylbutanoic acid;methanesulfonic acid;quinoline-3-carboxamide |
|---|---|
| PubChem CID | 87216988 |
| Molecular Formula | C26H35N5O7S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.23 |
| IUPAC Name | (2R)-2-[[(2S)-2,5-diaminopentanoyl]amino]-4-phenylbutanoic acid;methanesulfonic acid;quinoline-3-carboxamide |
| SMILES | CS(=O)(=O)O.NC(=O)c1cnc2ccccc2c1.NCCC[C@H](N)C(=O)N[C@H](CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H23N3O3.C10H8N2O.CH4O3S/c16-10-4-7-12(17)14(19)18-13(15(20)21)9-8-11-5-2-1-3-6-11;11-10(13)8-5-7-3-1-2-4-9(7)12-6-8;1-5(2,3)4/h1-3,5-6,12-13H,4,7-10,16-17H2,(H,18,19)(H,20,21);1-6H,(H2,11,13);1H3,(H,2,3,4)/t12-,13+;;/m0../s1 |
| InChIKey | WOSFPIFRZKEOKP-CQSOCPNPSA-N |
| XLogP | 1.09 |
| TPSA | 228.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|