C24H32Cl2N6O3 — CID 159382363
(2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2,6-dichloro-4-pyridinyl)-2-oxo-5-phenylpentan-3-yl]butanediamide (PubChem CID 159382363) has the molecular formula C24H32Cl2N6O3 and a molecular weight of 523.47 g/mol. Its IUPAC name is (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2,6-dichloro-4-pyridinyl)-2-oxo-5-phenylpentan-3-yl]butanediamide.
| Compound Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2,6-dichloro-4-pyridinyl)-2-oxo-5-phenylpentan-3-yl]butanediamide |
|---|---|
| PubChem CID | 159382363 |
| Molecular Formula | C24H32Cl2N6O3 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2,6-dichloro-4-pyridinyl)-2-oxo-5-phenylpentan-3-yl]butanediamide |
| SMILES | NCCN(CCN)C(=O)C[C@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)Cc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C24H32Cl2N6O3/c25-21-13-17(14-22(26)31-21)12-20(33)19(7-6-16-4-2-1-3-5-16)30-24(35)18(29)15-23(34)32(10-8-27)11-9-28/h1-5,13-14,18-19H,6-12,15,27-29H2,(H,30,35)/t18-,19-/m0/s1 |
| InChIKey | OILVHPRAGJOPDE-OALUTQOASA-N |
| XLogP | 1.08 |
| TPSA | 157.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|