C24H31Cl3N6O3 — CID 74389112
2-amino-N',N'-bis(2-aminoethyl)-N-[1-oxo-4-phenyl-1-(2,4,5-trichloroanilino)butan-2-yl]butanediamide (PubChem CID 74389112) has the molecular formula C24H31Cl3N6O3 and a molecular weight of 557.91 g/mol. Its IUPAC name is 2-amino-N',N'-bis(2-aminoethyl)-N-[1-oxo-4-phenyl-1-(2,4,5-trichloroanilino)butan-2-yl]butanediamide.
| Compound Name | 2-amino-N',N'-bis(2-aminoethyl)-N-[1-oxo-4-phenyl-1-(2,4,5-trichloroanilino)butan-2-yl]butanediamide |
|---|---|
| PubChem CID | 74389112 |
| Molecular Formula | C24H31Cl3N6O3 |
| Molecular Weight | 557.91 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-amino-N',N'-bis(2-aminoethyl)-N-[1-oxo-4-phenyl-1-(2,4,5-trichloroanilino)butan-2-yl]butanediamide |
| SMILES | NCCN(CCN)C(=O)CC(N)C(=O)NC(CCc1ccccc1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C24H31Cl3N6O3/c25-16-12-18(27)21(13-17(16)26)32-24(36)20(7-6-15-4-2-1-3-5-15)31-23(35)19(30)14-22(34)33(10-8-28)11-9-29/h1-5,12-13,19-20H,6-11,14,28-30H2,(H,31,35)(H,32,36) |
| InChIKey | MWOUNKCTFWYYHH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 156.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.91 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|