C27H34F6N6O4 — CID 46834360
(2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-1-oxo-4-phenylbutan-2-yl]butanediamide (PubChem CID 46834360) has the molecular formula C27H34F6N6O4 and a molecular weight of 620.60 g/mol. Its IUPAC name is (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-1-oxo-4-phenylbutan-2-yl]butanediamide.
| Compound Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-1-oxo-4-phenylbutan-2-yl]butanediamide |
|---|---|
| PubChem CID | 46834360 |
| Molecular Formula | C27H34F6N6O4 |
| Molecular Weight | 620.60 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(2S)-1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-1-oxo-4-phenylbutan-2-yl]butanediamide |
| SMILES | NCCN(CCN)C(=O)C[C@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H34F6N6O4/c28-26(29,30)25(43,27(31,32)33)18-7-9-19(10-8-18)37-24(42)21(11-6-17-4-2-1-3-5-17)38-23(41)20(36)16-22(40)39(14-12-34)15-13-35/h1-5,7-10,20-21,43H,6,11-16,34-36H2,(H,37,42)(H,38,41)/t20-,21-/m0/s1 |
| InChIKey | IJJVZYKUWGHLDN-SFTDATJTSA-N |
| XLogP | 1.52 |
| TPSA | 176.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.60 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |