C20H20Cl3N3O3 — CID 143988185
2-[(2-amino-4-oxobutanoyl)amino]-4-phenyl-N-(2,4,5-trichlorophenyl)butanamide (PubChem CID 143988185) has the molecular formula C20H20Cl3N3O3 and a molecular weight of 456.76 g/mol. Its IUPAC name is 2-[(2-amino-4-oxobutanoyl)amino]-4-phenyl-N-(2,4,5-trichlorophenyl)butanamide.
| Compound Name | 2-[(2-amino-4-oxobutanoyl)amino]-4-phenyl-N-(2,4,5-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 143988185 |
| Molecular Formula | C20H20Cl3N3O3 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2-[(2-amino-4-oxobutanoyl)amino]-4-phenyl-N-(2,4,5-trichlorophenyl)butanamide |
| SMILES | NC(CC=O)C(=O)NC(CCc1ccccc1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl3N3O3/c21-13-10-15(23)18(11-14(13)22)26-20(29)17(25-19(28)16(24)8-9-27)7-6-12-4-2-1-3-5-12/h1-5,9-11,16-17H,6-8,24H2,(H,25,28)(H,26,29) |
| InChIKey | HJWGCCMNAFGTTB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|