C25H33ClN6O5 — CID 158662955
(2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2-chloro-4-nitrophenyl)-2-oxo-5-phenylpentan-3-yl]butanediamide (PubChem CID 158662955) has the molecular formula C25H33ClN6O5 and a molecular weight of 533.03 g/mol. Its IUPAC name is (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2-chloro-4-nitrophenyl)-2-oxo-5-phenylpentan-3-yl]butanediamide.
| Compound Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2-chloro-4-nitrophenyl)-2-oxo-5-phenylpentan-3-yl]butanediamide |
|---|---|
| PubChem CID | 158662955 |
| Molecular Formula | C25H33ClN6O5 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (2S)-2-amino-N',N'-bis(2-aminoethyl)-N-[(3S)-1-(2-chloro-4-nitrophenyl)-2-oxo-5-phenylpentan-3-yl]butanediamide |
| SMILES | NCCN(CCN)C(=O)C[C@H](N)C(=O)N[C@@H](CCc1ccccc1)C(=O)Cc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C25H33ClN6O5/c26-20-15-19(32(36)37)8-7-18(20)14-23(33)22(9-6-17-4-2-1-3-5-17)30-25(35)21(29)16-24(34)31(12-10-27)13-11-28/h1-5,7-8,15,21-22H,6,9-14,16,27-29H2,(H,30,35)/t21-,22-/m0/s1 |
| InChIKey | CPFNQTSHPCDECF-VXKWHMMOSA-N |
| XLogP | 0.94 |
| TPSA | 187.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|