C23H35N3O3 — CID 162387399
(2R)-2-(4-cycloheptylbutanoylamino)-N-(2-phenylethyl)butanediamide (PubChem CID 162387399) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is (2R)-2-(4-cycloheptylbutanoylamino)-N-(2-phenylethyl)butanediamide.
| Compound Name | (2R)-2-(4-cycloheptylbutanoylamino)-N-(2-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 162387399 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (2R)-2-(4-cycloheptylbutanoylamino)-N-(2-phenylethyl)butanediamide |
| SMILES | NC(=O)C[C@@H](NC(=O)CCCC1CCCCCC1)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C23H35N3O3/c24-21(27)17-20(23(29)25-16-15-19-11-6-3-7-12-19)26-22(28)14-8-13-18-9-4-1-2-5-10-18/h3,6-7,11-12,18,20H,1-2,4-5,8-10,13-17H2,(H2,24,27)(H,25,29)(H,26,28)/t20-/m1/s1 |
| InChIKey | XRQXVGDEMGUYMF-HXUWFJFHSA-N |
| XLogP | 2.85 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |