C22H33N3O4 — CID 162387199
(2R)-2-(4-cyclohexylbutanoylamino)-N-[2-(4-hydroxyphenyl)ethyl]butanediamide (PubChem CID 162387199) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2R)-2-(4-cyclohexylbutanoylamino)-N-[2-(4-hydroxyphenyl)ethyl]butanediamide.
| Compound Name | (2R)-2-(4-cyclohexylbutanoylamino)-N-[2-(4-hydroxyphenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 162387199 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (2R)-2-(4-cyclohexylbutanoylamino)-N-[2-(4-hydroxyphenyl)ethyl]butanediamide |
| SMILES | NC(=O)C[C@@H](NC(=O)CCCC1CCCCC1)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C22H33N3O4/c23-20(27)15-19(22(29)24-14-13-17-9-11-18(26)12-10-17)25-21(28)8-4-7-16-5-2-1-3-6-16/h9-12,16,19,26H,1-8,13-15H2,(H2,23,27)(H,24,29)(H,25,28)/t19-/m1/s1 |
| InChIKey | RMJISNMQWWSXPQ-LJQANCHMSA-N |
| XLogP | 2.16 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |