C19H27N3O5 — CID 130436789
5-[[(2S)-3-(4-hydroxyphenyl)-2-(5-oxopentanoylamino)propanoyl]amino]pentanamide (PubChem CID 130436789) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 5-[[(2S)-3-(4-hydroxyphenyl)-2-(5-oxopentanoylamino)propanoyl]amino]pentanamide.
| Compound Name | 5-[[(2S)-3-(4-hydroxyphenyl)-2-(5-oxopentanoylamino)propanoyl]amino]pentanamide |
|---|---|
| PubChem CID | 130436789 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 5-[[(2S)-3-(4-hydroxyphenyl)-2-(5-oxopentanoylamino)propanoyl]amino]pentanamide |
| SMILES | NC(=O)CCCCNC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CCCC=O |
| InChI | InChI=1S/C19H27N3O5/c20-17(25)5-1-3-11-21-19(27)16(22-18(26)6-2-4-12-23)13-14-7-9-15(24)10-8-14/h7-10,12,16,24H,1-6,11,13H2,(H2,20,25)(H,21,27)(H,22,26)/t16-/m0/s1 |
| InChIKey | WCDPWROXEXLLLY-INIZCTEOSA-N |
| XLogP | 0.56 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|