C23H28N4O5 — CID 70938229
2-[3-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-phenylpropanamide (PubChem CID 70938229) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[3-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-phenylpropanamide.
| Compound Name | 2-[3-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 70938229 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[3-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]propanoylamino]-3-phenylpropanamide |
| SMILES | CC(=O)NC(Cc1ccc(O)cc1)C(=O)NCCC(=O)NC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C23H28N4O5/c1-15(28)26-20(14-17-7-9-18(29)10-8-17)23(32)25-12-11-21(30)27-19(22(24)31)13-16-5-3-2-4-6-16/h2-10,19-20,29H,11-14H2,1H3,(H2,24,31)(H,25,32)(H,26,28)(H,27,30) |
| InChIKey | LPQVWVVYSDBYMF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |