C24H32N4O5 — CID 163751309
2-[[(2R)-4-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-2-hydroxybutan-2-yl]amino]-3-phenylpropanamide (PubChem CID 163751309) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-[[(2R)-4-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-2-hydroxybutan-2-yl]amino]-3-phenylpropanamide.
| Compound Name | 2-[[(2R)-4-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-2-hydroxybutan-2-yl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 163751309 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-[[(2R)-4-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-2-hydroxybutan-2-yl]amino]-3-phenylpropanamide |
| SMILES | CC(=O)NC(Cc1ccc(O)cc1)C(=O)NCC[C@@](C)(O)NC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C24H32N4O5/c1-16(29)27-21(15-18-8-10-19(30)11-9-18)23(32)26-13-12-24(2,33)28-20(22(25)31)14-17-6-4-3-5-7-17/h3-11,20-21,28,30,33H,12-15H2,1-2H3,(H2,25,31)(H,26,32)(H,27,29)/t20?,21?,24-/m1/s1 |
| InChIKey | LQEWTHDCKIFGFC-SLXFGWRHSA-N |
| XLogP | 0.34 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|