C22H33N3O2S — CID 20679164
N'-[(2S)-3-cyclohexyl-1-(3-phenylpropylamino)-1-sulfanylidenepropan-2-yl]butanediamide (PubChem CID 20679164) has the molecular formula C22H33N3O2S and a molecular weight of 403.59 g/mol. Its IUPAC name is N'-[(2S)-3-cyclohexyl-1-(3-phenylpropylamino)-1-sulfanylidenepropan-2-yl]butanediamide.
| Compound Name | N'-[(2S)-3-cyclohexyl-1-(3-phenylpropylamino)-1-sulfanylidenepropan-2-yl]butanediamide |
|---|---|
| PubChem CID | 20679164 |
| Molecular Formula | C22H33N3O2S |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N'-[(2S)-3-cyclohexyl-1-(3-phenylpropylamino)-1-sulfanylidenepropan-2-yl]butanediamide |
| SMILES | NC(=O)CCC(=O)N[C@@H](CC1CCCCC1)C(=S)NCCCc1ccccc1 |
| InChI | InChI=1S/C22H33N3O2S/c23-20(26)13-14-21(27)25-19(16-18-10-5-2-6-11-18)22(28)24-15-7-12-17-8-3-1-4-9-17/h1,3-4,8-9,18-19H,2,5-7,10-16H2,(H2,23,26)(H,24,28)(H,25,27)/t19-/m0/s1 |
| InChIKey | YXVPAUWOHYWEAY-IBGZPJMESA-N |
| XLogP | 3.26 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|