C22H37N5O6 — CID 70090788
(2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-(2-carboxyethylamino)-4-(4-propylphenyl)butanoic acid (PubChem CID 70090788) has the molecular formula C22H37N5O6 and a molecular weight of 467.57 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-(2-carboxyethylamino)-4-(4-propylphenyl)butanoic acid.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-(2-carboxyethylamino)-4-(4-propylphenyl)butanoic acid |
|---|---|
| PubChem CID | 70090788 |
| Molecular Formula | C22H37N5O6 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;(2R)-2-(2-carboxyethylamino)-4-(4-propylphenyl)butanoic acid |
| SMILES | CCCc1ccc(CC[C@@H](NCCC(=O)O)C(=O)O)cc1.NC(N)=NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H23NO4.C6H14N4O2/c1-2-3-12-4-6-13(7-5-12)8-9-14(16(20)21)17-11-10-15(18)19;7-4(5(11)12)2-1-3-10-6(8)9/h4-7,14,17H,2-3,8-11H2,1H3,(H,18,19)(H,20,21);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t14-;4-/m10/s1 |
| InChIKey | ZXWRQZIWDQBSBK-UBLHBHKYSA-N |
| XLogP | 0.54 |
| TPSA | 214.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|