C19H30N2O6 — CID 21311205
2-amino-4-methylpentanoic acid;(2S)-2-[[(1R)-1-carboxyethyl]amino]-4-phenylbutanoic acid (PubChem CID 21311205) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;(2S)-2-[[(1R)-1-carboxyethyl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-amino-4-methylpentanoic acid;(2S)-2-[[(1R)-1-carboxyethyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 21311205 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;(2S)-2-[[(1R)-1-carboxyethyl]amino]-4-phenylbutanoic acid |
| SMILES | CC(C)CC(N)C(=O)O.C[C@@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C13H17NO4.C6H13NO2/c1-9(12(15)16)14-11(13(17)18)8-7-10-5-3-2-4-6-10;1-4(2)3-5(7)6(8)9/h2-6,9,11,14H,7-8H2,1H3,(H,15,16)(H,17,18);4-5H,3,7H2,1-2H3,(H,8,9)/t9-,11+;/m1./s1 |
| InChIKey | URDCUMNXFAPPEG-XQKZEKTMSA-N |
| XLogP | 1.58 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |