C13H17Cl2NO3 — CID 87484459
2-[[(2S)-1-chloro-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid;hydrochloride (PubChem CID 87484459) has the molecular formula C13H17Cl2NO3 and a molecular weight of 306.19 g/mol. Its IUPAC name is 2-[[(2S)-1-chloro-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid;hydrochloride.
| Compound Name | 2-[[(2S)-1-chloro-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87484459 |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[[(2S)-1-chloro-1-oxopropan-2-yl]amino]-4-phenylbutanoic acid;hydrochloride |
| SMILES | C[C@H](NC(CCc1ccccc1)C(=O)O)C(=O)Cl.Cl |
| InChI | InChI=1S/C13H16ClNO3.ClH/c1-9(12(14)16)15-11(13(17)18)8-7-10-5-3-2-4-6-10;/h2-6,9,11,15H,7-8H2,1H3,(H,17,18);1H/t9-,11?;/m0./s1 |
| InChIKey | MRTWDWVJATWMAG-QMOSYVFLSA-N |
| XLogP | 2.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|