C19H29NO5 — CID 20563086
2-(3-phenylmethoxypropylamino)nonanedioic acid (PubChem CID 20563086) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is 2-(3-phenylmethoxypropylamino)nonanedioic acid.
| Compound Name | 2-(3-phenylmethoxypropylamino)nonanedioic acid |
|---|---|
| PubChem CID | 20563086 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-(3-phenylmethoxypropylamino)nonanedioic acid |
| SMILES | O=C(O)CCCCCCC(NCCCOCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H29NO5/c21-18(22)12-7-2-1-6-11-17(19(23)24)20-13-8-14-25-15-16-9-4-3-5-10-16/h3-5,9-10,17,20H,1-2,6-8,11-15H2,(H,21,22)(H,23,24) |
| InChIKey | FYQMBCZBSCTOJN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|