C14H18N2O9 — CID 89081544
2-[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]pentanedioic acid (PubChem CID 89081544) has the molecular formula C14H18N2O9 and a molecular weight of 358.30 g/mol. Its IUPAC name is 2-[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]pentanedioic acid.
| Compound Name | 2-[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 89081544 |
| Molecular Formula | C14H18N2O9 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]pentanedioic acid |
| SMILES | O=C(O)CCC(NC(=O)Oc1cccc(CCON(O)O)c1)C(=O)O |
| InChI | InChI=1S/C14H18N2O9/c17-12(18)5-4-11(13(19)20)15-14(21)25-10-3-1-2-9(8-10)6-7-24-16(22)23/h1-3,8,11,22-23H,4-7H2,(H,15,21)(H,17,18)(H,19,20) |
| InChIKey | DDTDMHHEHCFBGU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|