C24H32N4O12 — CID 89081386
2,6-bis[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]hexanoic acid (PubChem CID 89081386) has the molecular formula C24H32N4O12 and a molecular weight of 568.54 g/mol. Its IUPAC name is 2,6-bis[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]hexanoic acid.
| Compound Name | 2,6-bis[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 89081386 |
| Molecular Formula | C24H32N4O12 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | 2,6-bis[[3-[2-(dihydroxyamino)oxyethyl]phenoxy]carbonylamino]hexanoic acid |
| SMILES | O=C(NCCCCC(NC(=O)Oc1cccc(CCON(O)O)c1)C(=O)O)Oc1cccc(CCON(O)O)c1 |
| InChI | InChI=1S/C24H32N4O12/c29-22(30)21(26-24(32)40-20-8-4-6-18(16-20)11-14-38-28(35)36)9-1-2-12-25-23(31)39-19-7-3-5-17(15-19)10-13-37-27(33)34/h3-8,15-16,21,33-36H,1-2,9-14H2,(H,25,31)(H,26,32)(H,29,30) |
| InChIKey | PWYXQJYNSRBVOP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 219.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|