C33H46N4O10 — CID 170414673
1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl 2,6-bis(phenoxycarbonylamino)hexanoate (PubChem CID 170414673) has the molecular formula C33H46N4O10 and a molecular weight of 658.75 g/mol. Its IUPAC name is 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl 2,6-bis(phenoxycarbonylamino)hexanoate.
| Compound Name | 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl 2,6-bis(phenoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 170414673 |
| Molecular Formula | C33H46N4O10 |
| Molecular Weight | 658.75 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | 1,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl 2,6-bis(phenoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)NCC(CNC(=O)OC(C)(C)C)OC(=O)C(CCCCNC(=O)Oc1ccccc1)NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C33H46N4O10/c1-32(2,3)46-29(40)35-21-25(22-36-30(41)47-33(4,5)6)43-27(38)26(37-31(42)45-24-17-11-8-12-18-24)19-13-14-20-34-28(39)44-23-15-9-7-10-16-23/h7-12,15-18,25-26H,13-14,19-22H2,1-6H3,(H,34,39)(H,35,40)(H,36,41)(H,37,42) |
| InChIKey | DFKCGJKHFAHKAJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 179.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.75 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|