C25H32N3O8- — CID 163137469
[4-[hydroxy(oxido)amino]phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 163137469) has the molecular formula C25H32N3O8- and a molecular weight of 502.54 g/mol. Its IUPAC name is [4-[hydroxy(oxido)amino]phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | [4-[hydroxy(oxido)amino]phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 163137469 |
| Molecular Formula | C25H32N3O8- |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | [4-[hydroxy(oxido)amino]phenyl] (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)Oc1ccc(N([O-])O)cc1 |
| InChI | InChI=1S/C25H32N3O8/c1-25(2,3)36-24(31)27-21(22(29)35-20-14-12-19(13-15-20)28(32)33)11-7-8-16-26-23(30)34-17-18-9-5-4-6-10-18/h4-6,9-10,12-15,21,32H,7-8,11,16-17H2,1-3H3,(H,26,30)(H,27,31)/q-1/t21-/m0/s1 |
| InChIKey | SKAQPDXHZQXTNR-NRFANRHFSA-N |
| XLogP | 4.28 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|