C41H60N4O12 — CID 160621562
1-O-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,2-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propyl] 8-O-phenyl 2-(phenoxycarbonylamino)octanedioate (PubChem CID 160621562) has the molecular formula C41H60N4O12 and a molecular weight of 800.95 g/mol. Its IUPAC name is 1-O-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,2-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propyl] 8-O-phenyl 2-(phenoxycarbonylamino)octanedioate.
| Compound Name | 1-O-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,2-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propyl] 8-O-phenyl 2-(phenoxycarbonylamino)octanedioate |
|---|---|
| PubChem CID | 160621562 |
| Molecular Formula | C41H60N4O12 |
| Molecular Weight | 800.95 g/mol |
| Exact Mass | 800.42 |
| IUPAC Name | 1-O-[3-[(2-methylpropan-2-yl)oxycarbonylamino]-2,2-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]propyl] 8-O-phenyl 2-(phenoxycarbonylamino)octanedioate |
| SMILES | CC(C)(C)OC(=O)NCC(CNC(=O)OC(C)(C)C)(CNC(=O)OC(C)(C)C)COC(=O)C(CCCCCC(=O)Oc1ccccc1)NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C41H60N4O12/c1-38(2,3)55-34(48)42-25-41(26-43-35(49)56-39(4,5)6,27-44-36(50)57-40(7,8)9)28-52-33(47)31(45-37(51)54-30-21-15-11-16-22-30)23-17-12-18-24-32(46)53-29-19-13-10-14-20-29/h10-11,13-16,19-22,31H,12,17-18,23-28H2,1-9H3,(H,42,48)(H,43,49)(H,44,50)(H,45,51) |
| InChIKey | RGTPMGHVGKARLN-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 205.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.95 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|