C18H24F2N2O12S2 — CID 11215139
(2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]-3,5-difluorophenoxy]carbonylamino]pentanedioic acid (PubChem CID 11215139) has the molecular formula C18H24F2N2O12S2 and a molecular weight of 562.52 g/mol. Its IUPAC name is (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]-3,5-difluorophenoxy]carbonylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]-3,5-difluorophenoxy]carbonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 11215139 |
| Molecular Formula | C18H24F2N2O12S2 |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.07 |
| IUPAC Name | (2S)-2-[[4-[bis(2-methylsulfonyloxyethyl)amino]-3,5-difluorophenoxy]carbonylamino]pentanedioic acid |
| SMILES | CS(=O)(=O)OCCN(CCOS(C)(=O)=O)c1c(F)cc(OC(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1F |
| InChI | InChI=1S/C18H24F2N2O12S2/c1-35(28,29)32-7-5-22(6-8-33-36(2,30)31)16-12(19)9-11(10-13(16)20)34-18(27)21-14(17(25)26)3-4-15(23)24/h9-10,14H,3-8H2,1-2H3,(H,21,27)(H,23,24)(H,25,26)/t14-/m0/s1 |
| InChIKey | DMSBPDYZGAGQLT-AWEZNQCLSA-N |
| XLogP | 0.13 |
| TPSA | 202.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|