C16H19Br2F2N3O5 — CID 11180108
(2S)-2-[[4-[bis(2-bromoethyl)amino]-3,5-difluorophenyl]carbamoylamino]pentanedioic acid (PubChem CID 11180108) has the molecular formula C16H19Br2F2N3O5 and a molecular weight of 531.15 g/mol. Its IUPAC name is (2S)-2-[[4-[bis(2-bromoethyl)amino]-3,5-difluorophenyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[bis(2-bromoethyl)amino]-3,5-difluorophenyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 11180108 |
| Molecular Formula | C16H19Br2F2N3O5 |
| Molecular Weight | 531.15 g/mol |
| Exact Mass | 528.97 |
| IUPAC Name | (2S)-2-[[4-[bis(2-bromoethyl)amino]-3,5-difluorophenyl]carbamoylamino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)Nc1cc(F)c(N(CCBr)CCBr)c(F)c1)C(=O)O |
| InChI | InChI=1S/C16H19Br2F2N3O5/c17-3-5-23(6-4-18)14-10(19)7-9(8-11(14)20)21-16(28)22-12(15(26)27)1-2-13(24)25/h7-8,12H,1-6H2,(H,24,25)(H,26,27)(H2,21,22,28)/t12-/m0/s1 |
| InChIKey | PEXWUXZGVJPLJI-LBPRGKRZSA-N |
| XLogP | 3.00 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|