C16H17Cl2F3N2O5 — CID 11430711
(2S)-2-[[4-[bis(2-chloroethyl)amino]-2,3,5-trifluorobenzoyl]amino]pentanedioic acid (PubChem CID 11430711) has the molecular formula C16H17Cl2F3N2O5 and a molecular weight of 445.22 g/mol. Its IUPAC name is (2S)-2-[[4-[bis(2-chloroethyl)amino]-2,3,5-trifluorobenzoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[4-[bis(2-chloroethyl)amino]-2,3,5-trifluorobenzoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 11430711 |
| Molecular Formula | C16H17Cl2F3N2O5 |
| Molecular Weight | 445.22 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (2S)-2-[[4-[bis(2-chloroethyl)amino]-2,3,5-trifluorobenzoyl]amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1cc(F)c(N(CCCl)CCCl)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C16H17Cl2F3N2O5/c17-3-5-23(6-4-18)14-9(19)7-8(12(20)13(14)21)15(26)22-10(16(27)28)1-2-11(24)25/h7,10H,1-6H2,(H,22,26)(H,24,25)(H,27,28)/t10-/m0/s1 |
| InChIKey | LHYPERAAYSLOIH-JTQLQIEISA-N |
| XLogP | 2.44 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|