C18H26Cl2N2O4 — CID 118276611
methyl 3-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(ethoxycarbonylamino)propanoate (PubChem CID 118276611) has the molecular formula C18H26Cl2N2O4 and a molecular weight of 405.32 g/mol. Its IUPAC name is methyl 3-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(ethoxycarbonylamino)propanoate.
| Compound Name | methyl 3-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(ethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 118276611 |
| Molecular Formula | C18H26Cl2N2O4 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | methyl 3-[4-[bis(2-chloroethyl)amino]-2-methylphenyl]-3-(ethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)NC(CC(=O)OC)c1ccc(N(CCCl)CCCl)cc1C |
| InChI | InChI=1S/C18H26Cl2N2O4/c1-4-26-18(24)21-16(12-17(23)25-3)15-6-5-14(11-13(15)2)22(9-7-19)10-8-20/h5-6,11,16H,4,7-10,12H2,1-3H3,(H,21,24) |
| InChIKey | QAMPHGWZDVTGOV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|